C30H63NO5P+ — CID 172707943
1-[hydroxy-[(2R)-2-methoxy-3-[(Z)-nonadec-10-enoxy]propoxy]phosphoryl]butyl-trimethylazanium (PubChem CID 172707943) has the molecular formula C30H63NO5P+ and a molecular weight of 548.81 g/mol. Its IUPAC name is 1-[hydroxy-[(2R)-2-methoxy-3-[(Z)-nonadec-10-enoxy]propoxy]phosphoryl]butyl-trimethylazanium.
| Compound Name | 1-[hydroxy-[(2R)-2-methoxy-3-[(Z)-nonadec-10-enoxy]propoxy]phosphoryl]butyl-trimethylazanium |
|---|---|
| PubChem CID | 172707943 |
| Molecular Formula | C30H63NO5P+ |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.44 |
| IUPAC Name | 1-[hydroxy-[(2R)-2-methoxy-3-[(Z)-nonadec-10-enoxy]propoxy]phosphoryl]butyl-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCOC[C@H](COP(=O)(O)C(CCC)[N+](C)(C)C)OC |
| InChI | InChI=1S/C30H62NO5P/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-35-27-29(34-6)28-36-37(32,33)30(25-8-2)31(3,4)5/h15-16,29-30H,7-14,17-28H2,1-6H3/p+1/b16-15-/t29-,30?/m1/s1 |
| InChIKey | DVVFNOOIKRHXJN-DDDHTDRZSA-O |
| XLogP | 8.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|