C36H72NO5P — CID 172805841
[(2R)-2-methoxy-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate (PubChem CID 172805841) has the molecular formula C36H72NO5P and a molecular weight of 629.95 g/mol. Its IUPAC name is [(2R)-2-methoxy-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate.
| Compound Name | [(2R)-2-methoxy-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate |
|---|---|
| PubChem CID | 172805841 |
| Molecular Formula | C36H72NO5P |
| Molecular Weight | 629.95 g/mol |
| Exact Mass | 629.51 |
| IUPAC Name | [(2R)-2-methoxy-3-[(6Z,18Z)-pentacosa-6,18-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC/C=C\CCCCCOC[C@H](COP(=O)([O-])C(CCC)[N+](C)(C)C)OC |
| InChI | InChI=1S/C36H72NO5P/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-32-41-33-35(40-6)34-42-43(38,39)36(31-8-2)37(3,4)5/h13-14,25-26,35-36H,7-12,15-24,27-34H2,1-6H3/b14-13-,26-25-/t35-,36?/m1/s1 |
| InChIKey | RMOVQGMFEFTLFT-XGQWLEMISA-N |
| XLogP | 9.96 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.95 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|