C34H70NO5P — CID 172823010
[(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate (PubChem CID 172823010) has the molecular formula C34H70NO5P and a molecular weight of 603.91 g/mol. Its IUPAC name is [(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate.
| Compound Name | [(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
|---|---|
| PubChem CID | 172823010 |
| Molecular Formula | C34H70NO5P |
| Molecular Weight | 603.91 g/mol |
| Exact Mass | 603.50 |
| IUPAC Name | [(2R)-3-[(Z)-henicos-10-enoxy]-2-[(2-methylpropan-2-yl)oxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
| SMILES | CCCCCCCCCC/C=C\CCCCCCCCCOC[C@H](COP(=O)([O-])C(CC)[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C34H70NO5P/c1-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-38-30-32(40-34(3,4)5)31-39-41(36,37)33(10-2)35(6,7)8/h19-20,32-33H,9-18,21-31H2,1-8H3/b20-19-/t32-,33?/m1/s1 |
| InChIKey | UMAVPVWPHPIXSH-MASMGBIFSA-N |
| XLogP | 9.41 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.91 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|