C26H52NO5P — CID 172782431
[(2R)-3-[(6Z,12Z)-hexadeca-6,12-dienoxy]-2-methoxypropoxy]-[1-(trimethylazaniumyl)propyl]phosphinate (PubChem CID 172782431) has the molecular formula C26H52NO5P and a molecular weight of 489.68 g/mol. Its IUPAC name is [(2R)-3-[(6Z,12Z)-hexadeca-6,12-dienoxy]-2-methoxypropoxy]-[1-(trimethylazaniumyl)propyl]phosphinate.
| Compound Name | [(2R)-3-[(6Z,12Z)-hexadeca-6,12-dienoxy]-2-methoxypropoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
|---|---|
| PubChem CID | 172782431 |
| Molecular Formula | C26H52NO5P |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | [(2R)-3-[(6Z,12Z)-hexadeca-6,12-dienoxy]-2-methoxypropoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
| SMILES | CCC/C=C\CCCC/C=C\CCCCCOC[C@H](COP(=O)([O-])C(CC)[N+](C)(C)C)OC |
| InChI | InChI=1S/C26H52NO5P/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-31-23-25(30-6)24-32-33(28,29)26(8-2)27(3,4)5/h10-11,16-17,25-26H,7-9,12-15,18-24H2,1-6H3/b11-10-,17-16-/t25-,26?/m1/s1 |
| InChIKey | OKZVULJQJOLJCC-AYVSLPFBSA-N |
| XLogP | 6.06 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|