C31H64NO5P — CID 172681849
[(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(Z)-octadec-9-enoxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate (PubChem CID 172681849) has the molecular formula C31H64NO5P and a molecular weight of 561.83 g/mol. Its IUPAC name is [(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(Z)-octadec-9-enoxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate.
| Compound Name | [(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(Z)-octadec-9-enoxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
|---|---|
| PubChem CID | 172681849 |
| Molecular Formula | C31H64NO5P |
| Molecular Weight | 561.83 g/mol |
| Exact Mass | 561.45 |
| IUPAC Name | [(2R)-2-[(2-methylpropan-2-yl)oxy]-3-[(Z)-octadec-9-enoxy]propoxy]-[1-(trimethylazaniumyl)propyl]phosphinate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC[C@H](COP(=O)([O-])C(CC)[N+](C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C31H64NO5P/c1-9-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-35-27-29(37-31(3,4)5)28-36-38(33,34)30(10-2)32(6,7)8/h17-18,29-30H,9-16,19-28H2,1-8H3/b18-17-/t29-,30?/m1/s1 |
| InChIKey | AMXXLFJULWIXCI-JJPFDOACSA-N |
| XLogP | 8.24 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.83 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|