C29H58NO5P — CID 172714363
[(2R)-2-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate (PubChem CID 172714363) has the molecular formula C29H58NO5P and a molecular weight of 531.76 g/mol. Its IUPAC name is [(2R)-2-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate.
| Compound Name | [(2R)-2-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate |
|---|---|
| PubChem CID | 172714363 |
| Molecular Formula | C29H58NO5P |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.41 |
| IUPAC Name | [(2R)-2-methoxy-3-[(6Z,12Z)-octadeca-6,12-dienoxy]propoxy]-[1-(trimethylazaniumyl)butyl]phosphinate |
| SMILES | CCCCC/C=C\CCCC/C=C\CCCCCOC[C@H](COP(=O)([O-])C(CCC)[N+](C)(C)C)OC |
| InChI | InChI=1S/C29H58NO5P/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-34-26-28(33-6)27-35-36(31,32)29(24-8-2)30(3,4)5/h12-13,18-19,28-29H,7-11,14-17,20-27H2,1-6H3/b13-12-,19-18-/t28-,29?/m1/s1 |
| InChIKey | FQXZJTRSNYXTCF-HNFFDZOESA-N |
| XLogP | 7.23 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|