C33H66NO7P — CID 172773698
1-[3,3-dihydroxypropyl(dimethyl)azaniumyl]propyl-[(2R)-3-[(10Z,16Z)-docosa-10,16-dienoxy]-2-hydroxypropoxy]phosphinate (PubChem CID 172773698) has the molecular formula C33H66NO7P and a molecular weight of 619.87 g/mol. Its IUPAC name is 1-[3,3-dihydroxypropyl(dimethyl)azaniumyl]propyl-[(2R)-3-[(10Z,16Z)-docosa-10,16-dienoxy]-2-hydroxypropoxy]phosphinate.
| Compound Name | 1-[3,3-dihydroxypropyl(dimethyl)azaniumyl]propyl-[(2R)-3-[(10Z,16Z)-docosa-10,16-dienoxy]-2-hydroxypropoxy]phosphinate |
|---|---|
| PubChem CID | 172773698 |
| Molecular Formula | C33H66NO7P |
| Molecular Weight | 619.87 g/mol |
| Exact Mass | 619.46 |
| IUPAC Name | 1-[3,3-dihydroxypropyl(dimethyl)azaniumyl]propyl-[(2R)-3-[(10Z,16Z)-docosa-10,16-dienoxy]-2-hydroxypropoxy]phosphinate |
| SMILES | CCCCC/C=C\CCCC/C=C\CCCCCCCCCOC[C@@H](O)COP(=O)([O-])C(CC)[N+](C)(C)CCC(O)O |
| InChI | InChI=1S/C33H66NO7P/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-28-40-29-31(35)30-41-42(38,39)32(6-2)34(3,4)27-26-33(36)37/h10-11,16-17,31-33,35-37H,5-9,12-15,18-30H2,1-4H3/b11-10-,17-16-/t31-,32?/m1/s1 |
| InChIKey | NHMKZUKPWWDLDT-ZSMAKJLPSA-N |
| XLogP | 6.82 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.87 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|