C26H53NO7P+ — CID 152750011
3,3-dihydroxypropyl-[1-[[(2R)-3-[(5Z,11Z)-hexadeca-5,11-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium (PubChem CID 152750011) has the molecular formula C26H53NO7P+ and a molecular weight of 522.68 g/mol. Its IUPAC name is 3,3-dihydroxypropyl-[1-[[(2R)-3-[(5Z,11Z)-hexadeca-5,11-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium.
| Compound Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(5Z,11Z)-hexadeca-5,11-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 152750011 |
| Molecular Formula | C26H53NO7P+ |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(5Z,11Z)-hexadeca-5,11-dienoxy]-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium |
| SMILES | CCCC/C=C\CCCC/C=C\CCCCOC[C@@H](O)COP(=O)(O)C(C)[N+](C)(C)CCC(O)O |
| InChI | InChI=1S/C26H52NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-33-22-25(28)23-34-35(31,32)24(2)27(3,4)20-19-26(29)30/h8-9,14-15,24-26,28-30H,5-7,10-13,16-23H2,1-4H3/p+1/b9-8-,15-14-/t24?,25-/m1/s1 |
| InChIKey | QWYQKQOGSSDORW-HYZZDWQVSA-O |
| XLogP | 4.72 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|