C36H71NO8P+ — CID 152751313
3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium (PubChem CID 152751313) has the molecular formula C36H71NO8P+ and a molecular weight of 676.94 g/mol. Its IUPAC name is 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium.
| Compound Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 152751313 |
| Molecular Formula | C36H71NO8P+ |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.49 |
| IUPAC Name | 3,3-dihydroxypropyl-[1-[[(2R)-3-[(6Z,18Z)-hexacosa-6,18-dienoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]ethyl]-dimethylazanium |
| SMILES | CCCCCCC/C=C\CCCCCCCCCC/C=C\CCCCC(=O)OC[C@@H](O)COP(=O)(O)C(C)[N+](C)(C)CCC(O)O |
| InChI | InChI=1S/C36H70NO8P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-36(41)44-31-34(38)32-45-46(42,43)33(2)37(3,4)30-29-35(39)40/h11-12,23-24,33-35,38-40H,5-10,13-22,25-32H2,1-4H3/p+1/b12-11-,24-23-/t33?,34-/m1/s1 |
| InChIKey | KGCSMZXKDBJSQG-MCSZNGPZSA-O |
| XLogP | 8.15 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|