C29H57NO8P+ — CID 152751309
3,3-dihydroxypropyl-[1-[hydroxy-[(2R)-2-hydroxy-3-[(5Z,11Z)-octadeca-5,11-dienoyl]oxypropoxy]phosphoryl]propyl]-dimethylazanium (PubChem CID 152751309) has the molecular formula C29H57NO8P+ and a molecular weight of 578.75 g/mol. Its IUPAC name is 3,3-dihydroxypropyl-[1-[hydroxy-[(2R)-2-hydroxy-3-[(5Z,11Z)-octadeca-5,11-dienoyl]oxypropoxy]phosphoryl]propyl]-dimethylazanium.
| Compound Name | 3,3-dihydroxypropyl-[1-[hydroxy-[(2R)-2-hydroxy-3-[(5Z,11Z)-octadeca-5,11-dienoyl]oxypropoxy]phosphoryl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 152751309 |
| Molecular Formula | C29H57NO8P+ |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.38 |
| IUPAC Name | 3,3-dihydroxypropyl-[1-[hydroxy-[(2R)-2-hydroxy-3-[(5Z,11Z)-octadeca-5,11-dienoyl]oxypropoxy]phosphoryl]propyl]-dimethylazanium |
| SMILES | CCCCCC/C=C\CCCC/C=C\CCCC(=O)OC[C@@H](O)COP(=O)(O)C(CC)[N+](C)(C)CCC(O)O |
| InChI | InChI=1S/C29H56NO8P/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-29(34)37-24-26(31)25-38-39(35,36)27(6-2)30(3,4)23-22-28(32)33/h11-12,17-18,26-28,31-33H,5-10,13-16,19-25H2,1-4H3/p+1/b12-11-,18-17-/t26-,27?/m1/s1 |
| InChIKey | KUPLFEKCKQQKPZ-TUEXDPRGSA-O |
| XLogP | 5.42 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|