C9H12O5 — CID 15275074
(1R,2R,5S,6S,7S,9R)-7,9-dimethyl-3,4,10,11-tetraoxatricyclo[4.3.1.12,5]undecan-8-one (PubChem CID 15275074) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1R,2R,5S,6S,7S,9R)-7,9-dimethyl-3,4,10,11-tetraoxatricyclo[4.3.1.12,5]undecan-8-one.
| Compound Name | (1R,2R,5S,6S,7S,9R)-7,9-dimethyl-3,4,10,11-tetraoxatricyclo[4.3.1.12,5]undecan-8-one |
|---|---|
| PubChem CID | 15275074 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1R,2R,5S,6S,7S,9R)-7,9-dimethyl-3,4,10,11-tetraoxatricyclo[4.3.1.12,5]undecan-8-one |
| SMILES | C[C@@H]1C(=O)[C@H](C)[C@H]2O[C@@H]1[C@@H]1OO[C@H]2O1 |
| InChI | InChI=1S/C9H12O5/c1-3-5(10)4(2)7-9-12-8(13-14-9)6(3)11-7/h3-4,6-9H,1-2H3/t3-,4+,6+,7-,8+,9- |
| InChIKey | UWNQVXXILVYNSK-AOBJGBLRSA-N |
| XLogP | 0.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|