C16H20N4O3S — CID 152750915
(3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)methyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 152750915) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)methyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)methyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 152750915 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-6-carbonylamino)methyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | CC1C[C@H]2CN(C(=O)O)[C@H](CNC(=O)c3cn4ccsc4n3)[C@H]2C1 |
| InChI | InChI=1S/C16H20N4O3S/c1-9-4-10-7-20(16(22)23)13(11(10)5-9)6-17-14(21)12-8-19-2-3-24-15(19)18-12/h2-3,8-11,13H,4-7H2,1H3,(H,17,21)(H,22,23)/t9?,10-,11-,13+/m0/s1 |
| InChIKey | QVMKDEVZYUENBV-SFRIWDOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |