C27H38Si — CID 152751043
[5-(1-butan-2-ylcyclohexa-2,4-dien-1-yl)-2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl]-(3,5-dimethylphenyl)silane (PubChem CID 152751043) has the molecular formula C27H38Si and a molecular weight of 390.69 g/mol. Its IUPAC name is [5-(1-butan-2-ylcyclohexa-2,4-dien-1-yl)-2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl]-(3,5-dimethylphenyl)silane.
| Compound Name | [5-(1-butan-2-ylcyclohexa-2,4-dien-1-yl)-2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl]-(3,5-dimethylphenyl)silane |
|---|---|
| PubChem CID | 152751043 |
| Molecular Formula | C27H38Si |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | [5-(1-butan-2-ylcyclohexa-2,4-dien-1-yl)-2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl]-(3,5-dimethylphenyl)silane |
| SMILES | CCC(C)C1(C2(C)C(C)=C(C)C(C)=C2[SiH2]c2cc(C)cc(C)c2)C=CC=CC1 |
| InChI | InChI=1S/C27H38Si/c1-9-20(4)27(13-11-10-12-14-27)26(8)23(7)21(5)22(6)25(26)28-24-16-18(2)15-19(3)17-24/h10-13,15-17,20H,9,14,28H2,1-8H3 |
| InChIKey | GJGRTRKRIKCJFE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|