C18H21F3O4S — CID 152751521
[2-(1-adamantyl)-4-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 152751521) has the molecular formula C18H21F3O4S and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-(1-adamantyl)-4-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-(1-adamantyl)-4-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 152751521 |
| Molecular Formula | C18H21F3O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-(1-adamantyl)-4-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)C(F)(F)F)c(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C18H21F3O4S/c1-24-14-2-3-16(25-26(22,23)18(19,20)21)15(7-14)17-8-11-4-12(9-17)6-13(5-11)10-17/h2-3,7,11-13H,4-6,8-10H2,1H3 |
| InChIKey | NMTSWXUWIQULIB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|