C8H9NO — CID 152753524
2,3,4,4a-tetrahydrobenzo[b][1,4]oxazine (PubChem CID 152753524) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3,4,4a-tetrahydrobenzo[b][1,4]oxazine.
| Compound Name | 2,3,4,4a-tetrahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 152753524 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2,3,4,4a-tetrahydrobenzo[b][1,4]oxazine |
| SMILES | C1=CC=C2OCCNC2C=1 |
| InChI | InChI=1S/C8H9NO/c1-2-4-8-7(3-1)9-5-6-10-8/h2-4,7,9H,5-6H2 |
| InChIKey | RYNKJUHORIDCIH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |