C8H12N2O — CID 175834463
3,4,4a,5-tetrahydro-2H-1,4-benzoxazin-8-amine (PubChem CID 175834463) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-2H-1,4-benzoxazin-8-amine.
| Compound Name | 3,4,4a,5-tetrahydro-2H-1,4-benzoxazin-8-amine |
|---|---|
| PubChem CID | 175834463 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3,4,4a,5-tetrahydro-2H-1,4-benzoxazin-8-amine |
| SMILES | NC1=C2OCCNC2CC=C1 |
| InChI | InChI=1S/C8H12N2O/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-2,7,10H,3-5,9H2 |
| InChIKey | VBSYBIRHCBLYQO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |