C5H12N2O2Se — CID 152756500
(2R)-2-(2-aminoethylamino)-3-selanylpropanoic acid (PubChem CID 152756500) has the molecular formula C5H12N2O2Se and a molecular weight of 211.12 g/mol. Its IUPAC name is (2R)-2-(2-aminoethylamino)-3-selanylpropanoic acid.
| Compound Name | (2R)-2-(2-aminoethylamino)-3-selanylpropanoic acid |
|---|---|
| PubChem CID | 152756500 |
| Molecular Formula | C5H12N2O2Se |
| Molecular Weight | 211.12 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | (2R)-2-(2-aminoethylamino)-3-selanylpropanoic acid |
| SMILES | NCCN[C@@H](C[SeH])C(=O)O |
| InChI | InChI=1S/C5H12N2O2Se/c6-1-2-7-4(3-10)5(8)9/h4,7,10H,1-3,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | WQGIRKIZIQSCNU-BYPYZUCNSA-N |
| XLogP | -1.69 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.12 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|