C16H18N4O8 — CID 152770100
6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-nitrobenzoyl)-1H-pyrimidin-2-one (PubChem CID 152770100) has the molecular formula C16H18N4O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-nitrobenzoyl)-1H-pyrimidin-2-one.
| Compound Name | 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-nitrobenzoyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 152770100 |
| Molecular Formula | C16H18N4O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-nitrobenzoyl)-1H-pyrimidin-2-one |
| SMILES | NC1(C(=O)c2ccccc2[N+](=O)[O-])C=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C16H18N4O8/c17-16(13(24)8-3-1-2-4-9(8)20(26)27)5-6-19(15(25)18-16)14-12(23)11(22)10(7-21)28-14/h1-6,10-12,14,21-23H,7,17H2,(H,18,25)/t10-,11-,12-,14-,16?/m1/s1 |
| InChIKey | UOYJNQIKMINIDO-FPVIDPCTSA-N |
| XLogP | -1.59 |
| TPSA | 188.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|