C16H17Cl2N3O6 — CID 152770420
6-amino-6-(3,5-dichlorobenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidin-2-one (PubChem CID 152770420) has the molecular formula C16H17Cl2N3O6 and a molecular weight of 418.23 g/mol. Its IUPAC name is 6-amino-6-(3,5-dichlorobenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-amino-6-(3,5-dichlorobenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 152770420 |
| Molecular Formula | C16H17Cl2N3O6 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 6-amino-6-(3,5-dichlorobenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyrimidin-2-one |
| SMILES | NC1(C(=O)c2cc(Cl)cc(Cl)c2)C=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C16H17Cl2N3O6/c17-8-3-7(4-9(18)5-8)13(25)16(19)1-2-21(15(26)20-16)14-12(24)11(23)10(6-22)27-14/h1-5,10-12,14,22-24H,6,19H2,(H,20,26)/t10-,11-,12-,14-,16?/m1/s1 |
| InChIKey | CBUIKOLCGIKNNM-FPVIDPCTSA-N |
| XLogP | -0.19 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |