C23H32FN3O8 — CID 161314698
6-amino-6-(4-tert-butylbenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-1H-pyrimidin-2-one;1,3-dioxolane (PubChem CID 161314698) has the molecular formula C23H32FN3O8 and a molecular weight of 497.52 g/mol. Its IUPAC name is 6-amino-6-(4-tert-butylbenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-1H-pyrimidin-2-one;1,3-dioxolane.
| Compound Name | 6-amino-6-(4-tert-butylbenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-1H-pyrimidin-2-one;1,3-dioxolane |
|---|---|
| PubChem CID | 161314698 |
| Molecular Formula | C23H32FN3O8 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 6-amino-6-(4-tert-butylbenzoyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoro-1H-pyrimidin-2-one;1,3-dioxolane |
| SMILES | C1COCO1.CC(C)(C)c1ccc(C(=O)C2(N)NC(=O)N([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C=C2F)cc1 |
| InChI | InChI=1S/C20H26FN3O6.C3H6O2/c1-19(2,3)11-6-4-10(5-7-11)16(28)20(22)13(21)8-24(18(29)23-20)17-15(27)14(26)12(9-25)30-17;1-2-5-3-4-1/h4-8,12,14-15,17,25-27H,9,22H2,1-3H3,(H,23,29);1-3H2/t12-,14-,15-,17-,20?;/m1./s1 |
| InChIKey | VJIOXTJEWOVPQI-OZAMUCLBSA-N |
| XLogP | 0.09 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |