C16H27N3O7 — CID 152780389
hexyl 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidine-6-carboxylate (PubChem CID 152780389) has the molecular formula C16H27N3O7 and a molecular weight of 373.41 g/mol. Its IUPAC name is hexyl 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidine-6-carboxylate.
| Compound Name | hexyl 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 152780389 |
| Molecular Formula | C16H27N3O7 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | hexyl 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidine-6-carboxylate |
| SMILES | CCCCCCOC(=O)C1(N)C=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C16H27N3O7/c1-2-3-4-5-8-25-14(23)16(17)6-7-19(15(24)18-16)13-12(22)11(21)10(9-20)26-13/h6-7,10-13,20-22H,2-5,8-9,17H2,1H3,(H,18,24)/t10-,11-,12-,13-,16?/m1/s1 |
| InChIKey | QXHOURZGPBKDOG-QLJSRWMYSA-N |
| XLogP | -1.26 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|