C17H23N3O13P2 — CID 172735472
[[6-amino-6-benzoyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidin-5-yl]oxy-phosphonomethyl]phosphonic acid (PubChem CID 172735472) has the molecular formula C17H23N3O13P2 and a molecular weight of 539.33 g/mol. Its IUPAC name is [[6-amino-6-benzoyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidin-5-yl]oxy-phosphonomethyl]phosphonic acid.
| Compound Name | [[6-amino-6-benzoyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidin-5-yl]oxy-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 172735472 |
| Molecular Formula | C17H23N3O13P2 |
| Molecular Weight | 539.33 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | [[6-amino-6-benzoyl-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-1H-pyrimidin-5-yl]oxy-phosphonomethyl]phosphonic acid |
| SMILES | NC1(C(=O)c2ccccc2)NC(=O)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C=C1OC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C17H23N3O13P2/c18-17(13(24)8-4-2-1-3-5-8)10(33-16(34(26,27)28)35(29,30)31)6-20(15(25)19-17)14-12(23)11(22)9(7-21)32-14/h1-6,9,11-12,14,16,21-23H,7,18H2,(H,19,25)(H2,26,27,28)(H2,29,30,31)/t9-,11-,12-,14-,17?/m1/s1 |
| InChIKey | IJHIWEBYQDPIRJ-JDMVWBQASA-N |
| XLogP | -2.51 |
| TPSA | 269.64 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.33 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|