C50H33N — CID 152773378
N,N,3,15-tetraphenylheptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-8-amine (PubChem CID 152773378) has the molecular formula C50H33N and a molecular weight of 647.82 g/mol. Its IUPAC name is N,N,3,15-tetraphenylheptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-8-amine.
| Compound Name | N,N,3,15-tetraphenylheptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-8-amine |
|---|---|
| PubChem CID | 152773378 |
| Molecular Formula | C50H33N |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | N,N,3,15-tetraphenylheptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaen-8-amine |
| SMILES | C1=CC2=CC=CC3=c4c(c(-c5ccccc5)c5c(c4-c4ccccc4)C4=CC=C(N(c6ccccc6)c6ccccc6)C6=CC=CC=5C64)C(=C1)C23 |
| InChI | InChI=1S/C50H33N/c1-5-16-33(17-6-1)44-47-38-27-13-20-32-21-14-28-39(43(32)38)48(47)45(34-18-7-2-8-19-34)50-41-30-31-42(37-26-15-29-40(46(37)41)49(44)50)51(35-22-9-3-10-23-35)36-24-11-4-12-25-36/h1-31,43,46H |
| InChIKey | AUFDZFVQWPKLIR-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |