C19H15NO — CID 152780748
4-phenyl-1,3-dihydrobenzo[f]quinolin-2-one (PubChem CID 152780748) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-phenyl-1,3-dihydrobenzo[f]quinolin-2-one.
| Compound Name | 4-phenyl-1,3-dihydrobenzo[f]quinolin-2-one |
|---|---|
| PubChem CID | 152780748 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-phenyl-1,3-dihydrobenzo[f]quinolin-2-one |
| SMILES | O=C1Cc2c(ccc3ccccc23)N(c2ccccc2)C1 |
| InChI | InChI=1S/C19H15NO/c21-16-12-18-17-9-5-4-6-14(17)10-11-19(18)20(13-16)15-7-2-1-3-8-15/h1-11H,12-13H2 |
| InChIKey | NOVMZRSTLBAPQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |