C14H10N2 — CID 159057231
11,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,14-heptaene (PubChem CID 159057231) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 11,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,14-heptaene.
| Compound Name | 11,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,14-heptaene |
|---|---|
| PubChem CID | 159057231 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 11,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,14-heptaene |
| SMILES | c1ccc2c3c(ccc2c1)-n1cncc1C3 |
| InChI | InChI=1S/C14H10N2/c1-2-4-12-10(3-1)5-6-14-13(12)7-11-8-15-9-16(11)14/h1-6,8-9H,7H2 |
| InChIKey | HARSMTDTRAVITM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |