C20H12Cl2N2O3 — CID 152782471
5,7-dichloro-3-imino-4,6-diphenoxyisoindol-1-one (PubChem CID 152782471) has the molecular formula C20H12Cl2N2O3 and a molecular weight of 399.23 g/mol. Its IUPAC name is 5,7-dichloro-3-imino-4,6-diphenoxyisoindol-1-one.
| Compound Name | 5,7-dichloro-3-imino-4,6-diphenoxyisoindol-1-one |
|---|---|
| PubChem CID | 152782471 |
| Molecular Formula | C20H12Cl2N2O3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 5,7-dichloro-3-imino-4,6-diphenoxyisoindol-1-one |
| SMILES | [H]/N=C1\NC(=O)c2c(Cl)c(Oc3ccccc3)c(Cl)c(Oc3ccccc3)c21 |
| InChI | InChI=1S/C20H12Cl2N2O3/c21-15-13-14(19(23)24-20(13)25)17(26-11-7-3-1-4-8-11)16(22)18(15)27-12-9-5-2-6-10-12/h1-10H,(H2,23,24,25) |
| InChIKey | OSYOZGQMKTXGGF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|