C11H10N4O3 — CID 152817740
3-[2-(1-hydroxybenzotriazol-5-yl)ethyl]-4H-1,2-oxazol-5-one (PubChem CID 152817740) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-[2-(1-hydroxybenzotriazol-5-yl)ethyl]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[2-(1-hydroxybenzotriazol-5-yl)ethyl]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 152817740 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-[2-(1-hydroxybenzotriazol-5-yl)ethyl]-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(CCc2ccc3c(c2)nnn3O)=NO1 |
| InChI | InChI=1S/C11H10N4O3/c16-11-6-8(13-18-11)3-1-7-2-4-10-9(5-7)12-14-15(10)17/h2,4-5,17H,1,3,6H2 |
| InChIKey | SSXAVDZNNRACMV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|