C6H4KN3O4S — CID 157234780
potassium 1-hydroxybenzotriazole-5-sulfonate (PubChem CID 157234780) has the molecular formula C6H4KN3O4S and a molecular weight of 253.28 g/mol. Its IUPAC name is potassium 1-hydroxybenzotriazole-5-sulfonate.
| Compound Name | potassium 1-hydroxybenzotriazole-5-sulfonate |
|---|---|
| PubChem CID | 157234780 |
| Molecular Formula | C6H4KN3O4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | potassium 1-hydroxybenzotriazole-5-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1)nnn2O.[K+] |
| InChI | InChI=1S/C6H5N3O4S.K/c10-9-6-2-1-4(14(11,12)13)3-5(6)7-8-9;/h1-3,10H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | AUMVVNRZMFUTCS-UHFFFAOYSA-M |
| XLogP | -3.42 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|