C24H25N3O3 — CID 152824249
N-[[1-(4-ethenoxy-3-methoxyphenyl)cyclopentyl]methyl]cinnoline-4-carboxamide (PubChem CID 152824249) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-[[1-(4-ethenoxy-3-methoxyphenyl)cyclopentyl]methyl]cinnoline-4-carboxamide.
| Compound Name | N-[[1-(4-ethenoxy-3-methoxyphenyl)cyclopentyl]methyl]cinnoline-4-carboxamide |
|---|---|
| PubChem CID | 152824249 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[[1-(4-ethenoxy-3-methoxyphenyl)cyclopentyl]methyl]cinnoline-4-carboxamide |
| SMILES | C=COc1ccc(C2(CNC(=O)c3cnnc4ccccc34)CCCC2)cc1OC |
| InChI | InChI=1S/C24H25N3O3/c1-3-30-21-11-10-17(14-22(21)29-2)24(12-6-7-13-24)16-25-23(28)19-15-26-27-20-9-5-4-8-18(19)20/h3-5,8-11,14-15H,1,6-7,12-13,16H2,2H3,(H,25,28) |
| InChIKey | SUMXHWSRAMPLGV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|