C22H21ClF5O5P — CID 152827269
cyclohexyl (2S)-3-[(4-chlorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-methylpropanoate (PubChem CID 152827269) has the molecular formula C22H21ClF5O5P and a molecular weight of 526.82 g/mol. Its IUPAC name is cyclohexyl (2S)-3-[(4-chlorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-methylpropanoate.
| Compound Name | cyclohexyl (2S)-3-[(4-chlorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 152827269 |
| Molecular Formula | C22H21ClF5O5P |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | cyclohexyl (2S)-3-[(4-chlorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]-2-methylpropanoate |
| SMILES | C[C@H](CP(=O)(Oc1ccc(Cl)cc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C22H21ClF5O5P/c1-12(22(29)31-14-5-3-2-4-6-14)11-34(30,32-15-9-7-13(23)8-10-15)33-21-19(27)17(25)16(24)18(26)20(21)28/h7-10,12,14H,2-6,11H2,1H3/t12-,34?/m1/s1 |
| InChIKey | SVIJUCAWUVXGKC-AGQYVJBWSA-N |
| XLogP | 7.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|