C19H17F5NO5P — CID 175420848
cyclobutyl 2-[fluoro-[phenoxy-(2,3,4,5-tetrafluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 175420848) has the molecular formula C19H17F5NO5P and a molecular weight of 465.31 g/mol. Its IUPAC name is cyclobutyl 2-[fluoro-[phenoxy-(2,3,4,5-tetrafluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclobutyl 2-[fluoro-[phenoxy-(2,3,4,5-tetrafluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 175420848 |
| Molecular Formula | C19H17F5NO5P |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | cyclobutyl 2-[fluoro-[phenoxy-(2,3,4,5-tetrafluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C(=O)OC1CCC1)N(F)P(=O)(Oc1ccccc1)Oc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H17F5NO5P/c1-11(19(26)28-12-8-5-9-12)25(24)31(27,29-13-6-3-2-4-7-13)30-15-10-14(20)16(21)18(23)17(15)22/h2-4,6-7,10-12H,5,8-9H2,1H3 |
| InChIKey | ZOAVYLPODRVOTN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|