C18H17F5NO6P — CID 175724925
(2R)-2-hydroxy-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid (PubChem CID 175724925) has the molecular formula C18H17F5NO6P and a molecular weight of 469.30 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid.
| Compound Name | (2R)-2-hydroxy-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 175724925 |
| Molecular Formula | C18H17F5NO6P |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | (2R)-2-hydroxy-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N([C@](C)(O)C(=O)O)[P@](=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H17F5NO6P/c1-9(2)24(18(3,27)17(25)26)31(28,29-10-7-5-4-6-8-10)30-16-14(22)12(20)11(19)13(21)15(16)23/h4-9,27H,1-3H3,(H,25,26)/t18-,31+/m1/s1 |
| InChIKey | RVNGIAFEOMIIPL-OKXSDPAFSA-N |
| XLogP | 4.45 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|