C24H23NO4S — CID 15286681
(4S)-5-(benzenesulfonyl)-1-benzyl-4-phenylmethoxypyrrolidin-2-one (PubChem CID 15286681) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is (4S)-5-(benzenesulfonyl)-1-benzyl-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S)-5-(benzenesulfonyl)-1-benzyl-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 15286681 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (4S)-5-(benzenesulfonyl)-1-benzyl-4-phenylmethoxypyrrolidin-2-one |
| SMILES | O=C1C[C@H](OCc2ccccc2)C(S(=O)(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c26-23-16-22(29-18-20-12-6-2-7-13-20)24(25(23)17-19-10-4-1-5-11-19)30(27,28)21-14-8-3-9-15-21/h1-15,22,24H,16-18H2/t22-,24?/m0/s1 |
| InChIKey | GRZAKCXNSVVPEK-OWJIYDKWSA-N |
| XLogP | 3.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |