C21H17FO6S — CID 152947974
methyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 152947974) has the molecular formula C21H17FO6S and a molecular weight of 416.43 g/mol. Its IUPAC name is methyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 152947974 |
| Molecular Formula | C21H17FO6S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | methyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)c2cccc(-c3cc(F)ccc3O)c2)cc1O |
| InChI | InChI=1S/C21H17FO6S/c1-28-21(25)17-7-5-13(9-20(17)24)12-29(26,27)16-4-2-3-14(10-16)18-11-15(22)6-8-19(18)23/h2-11,23-24H,12H2,1H3 |
| InChIKey | UOCZWXMLPOEEOS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |