About CID 152996738
CID 152996738 (PubChem CID 152996738) has the molecular formula C17H11BN2S
and a molecular weight of 286.17 g/mol.
Molecular Properties
| Compound Name | CID 152996738 |
| PubChem CID | 152996738 |
| Molecular Formula | C17H11BN2S |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2ncc(-c3ccc(-c4ccccc4)s3)n2c1 |
| InChI | InChI=1S/C17H11BN2S/c18-13-6-9-17-19-10-14(20(17)11-13)16-8-7-15(21-16)12-4-2-1-3-5-12/h1-11H |
| InChIKey | CTWMKRIOFQWMJO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 152996738 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152996738?
The IUPAC name of CID 152996738 (CID 152996738) is not available.
What is the SMILES notation for CID 152996738?
The canonical SMILES for CID 152996738 is [B]c1ccc2ncc(-c3ccc(-c4ccccc4)s3)n2c1.
What is the InChIKey of CID 152996738?
The InChIKey is CTWMKRIOFQWMJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BN2S/c18-13-6-9-17-19-10-14(20(17)11-13)16-8-7-15(21-16)12-4-2-1-3-5-12/h1-11H.
What are the key properties of CID 152996738?
CID 152996738 has a molecular weight of 286.17 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152996738 is sourced from PubChem (CID 152996738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).