C15H22NO3P — CID 153035554
benzyl 8-hydroxy-1-phosphanylazocane-2-carboxylate (PubChem CID 153035554) has the molecular formula C15H22NO3P and a molecular weight of 295.32 g/mol. Its IUPAC name is benzyl 8-hydroxy-1-phosphanylazocane-2-carboxylate.
| Compound Name | benzyl 8-hydroxy-1-phosphanylazocane-2-carboxylate |
|---|---|
| PubChem CID | 153035554 |
| Molecular Formula | C15H22NO3P |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | benzyl 8-hydroxy-1-phosphanylazocane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CCCCCC(O)N1P |
| InChI | InChI=1S/C15H22NO3P/c17-14-10-6-2-5-9-13(16(14)20)15(18)19-11-12-7-3-1-4-8-12/h1,3-4,7-8,13-14,17H,2,5-6,9-11,20H2 |
| InChIKey | VERAZISJBOZGPW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|