C33H41IrN2O2- — CID 153038125
4-hydroxypent-3-en-2-one;iridium;3,6,11-tris(2-methylpropyl)-12H-phenanthro[9,10-b]pyrazin-12-ide (PubChem CID 153038125) has the molecular formula C33H41IrN2O2- and a molecular weight of 689.92 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;iridium;3,6,11-tris(2-methylpropyl)-12H-phenanthro[9,10-b]pyrazin-12-ide.
| Compound Name | 4-hydroxypent-3-en-2-one;iridium;3,6,11-tris(2-methylpropyl)-12H-phenanthro[9,10-b]pyrazin-12-ide |
|---|---|
| PubChem CID | 153038125 |
| Molecular Formula | C33H41IrN2O2- |
| Molecular Weight | 689.92 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;iridium;3,6,11-tris(2-methylpropyl)-12H-phenanthro[9,10-b]pyrazin-12-ide |
| SMILES | CC(=O)C=C(C)O.CC(C)Cc1[c-]c2c(cc1)c1ccc(CC(C)C)cc1c1nc(CC(C)C)cnc21.[Ir] |
| InChI | InChI=1S/C28H33N2.C5H8O2.Ir/c1-17(2)11-20-7-9-23-24-10-8-21(12-18(3)4)15-26(24)28-27(25(23)14-20)29-16-22(30-28)13-19(5)6;1-4(6)3-5(2)7;/h7-10,15-19H,11-13H2,1-6H3;3,6H,1-2H3;/q-1;; |
| InChIKey | KBSBLZZADRWIJH-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.92 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|