C14H10N4O6S — CID 153048353
8-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 153048353) has the molecular formula C14H10N4O6S and a molecular weight of 362.32 g/mol. Its IUPAC name is 8-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 8-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 153048353 |
| Molecular Formula | C14H10N4O6S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 8-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | O=C1NC(=O)C(/N=N/c2cccc3cccc(S(=O)(=O)O)c23)C(=O)N1 |
| InChI | InChI=1S/C14H10N4O6S/c19-12-11(13(20)16-14(21)15-12)18-17-8-5-1-3-7-4-2-6-9(10(7)8)25(22,23)24/h1-6,11H,(H,22,23,24)(H2,15,16,19,20,21)/b18-17+ |
| InChIKey | VHBHZFOKJYXBFP-ISLYRVAYSA-N |
| XLogP | 0.90 |
| TPSA | 154.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|