C19H13N3O3 — CID 15304900
3-acetyl-2-anilinobenzo[f]benzimidazole-4,9-dione (PubChem CID 15304900) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-acetyl-2-anilinobenzo[f]benzimidazole-4,9-dione.
| Compound Name | 3-acetyl-2-anilinobenzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 15304900 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-acetyl-2-anilinobenzo[f]benzimidazole-4,9-dione |
| SMILES | CC(=O)n1c(Nc2ccccc2)nc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H13N3O3/c1-11(23)22-16-15(21-19(22)20-12-7-3-2-4-8-12)17(24)13-9-5-6-10-14(13)18(16)25/h2-10H,1H3,(H,20,21) |
| InChIKey | HGNUBNKGBICLOU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|