C18H16N2O2 — CID 10541659
2-(cyclopentylidenemethyl)-3-methylbenzo[f]benzimidazole-4,9-dione (PubChem CID 10541659) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(cyclopentylidenemethyl)-3-methylbenzo[f]benzimidazole-4,9-dione.
| Compound Name | 2-(cyclopentylidenemethyl)-3-methylbenzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 10541659 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(cyclopentylidenemethyl)-3-methylbenzo[f]benzimidazole-4,9-dione |
| SMILES | Cn1c(C=C2CCCC2)nc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16N2O2/c1-20-14(10-11-6-2-3-7-11)19-15-16(20)18(22)13-9-5-4-8-12(13)17(15)21/h4-5,8-10H,2-3,6-7H2,1H3 |
| InChIKey | AGDQSANXAOEMFR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|