C20H27ClN4O4 — CID 153062083
[2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]but-2-enoate (PubChem CID 153062083) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]but-2-enoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]but-2-enoate |
|---|---|
| PubChem CID | 153062083 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]but-2-enoate |
| SMILES | CC(N)=C(C(=O)OCC(=O)c1ccccc1Cl)/C(N)=N/CCCN1CCOCC1 |
| InChI | InChI=1S/C20H27ClN4O4/c1-14(22)18(19(23)24-7-4-8-25-9-11-28-12-10-25)20(27)29-13-17(26)15-5-2-3-6-16(15)21/h2-3,5-6H,4,7-13,22H2,1H3,(H2,23,24) |
| InChIKey | RIRTVLWPAFGOSS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|