C20H25F3N4O4 — CID 154613585
[2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl] (E)-3-amino-2-[N'-(2-morpholin-4-ylethyl)carbamimidoyl]but-2-enoate (PubChem CID 154613585) has the molecular formula C20H25F3N4O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl] (E)-3-amino-2-[N'-(2-morpholin-4-ylethyl)carbamimidoyl]but-2-enoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl] (E)-3-amino-2-[N'-(2-morpholin-4-ylethyl)carbamimidoyl]but-2-enoate |
|---|---|
| PubChem CID | 154613585 |
| Molecular Formula | C20H25F3N4O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)phenyl]ethyl] (E)-3-amino-2-[N'-(2-morpholin-4-ylethyl)carbamimidoyl]but-2-enoate |
| SMILES | C/C(N)=C(C(=O)OCC(=O)c1ccccc1C(F)(F)F)/C(N)=N/CCN1CCOCC1 |
| InChI | InChI=1S/C20H25F3N4O4/c1-13(24)17(18(25)26-6-7-27-8-10-30-11-9-27)19(29)31-12-16(28)14-4-2-3-5-15(14)20(21,22)23/h2-5H,6-12,24H2,1H3,(H2,25,26)/b17-13+ |
| InChIKey | OCDNZZOVSLRMHI-GHRIWEEISA-N |
| XLogP | 1.35 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|