C19H25F2N5O3 — CID 154613392
[2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]but-2-enoate (PubChem CID 154613392) has the molecular formula C19H25F2N5O3 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]but-2-enoate.
| Compound Name | [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]but-2-enoate |
|---|---|
| PubChem CID | 154613392 |
| Molecular Formula | C19H25F2N5O3 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]but-2-enoate |
| SMILES | C/C(N)=C(C(=O)OCC(=O)c1c(F)cccc1F)/C(N)=N/CCN1CCNCC1 |
| InChI | InChI=1S/C19H25F2N5O3/c1-12(22)16(18(23)25-7-10-26-8-5-24-6-9-26)19(28)29-11-15(27)17-13(20)3-2-4-14(17)21/h2-4,24H,5-11,22H2,1H3,(H2,23,25)/b16-12+ |
| InChIKey | XJXYHYQMPXNZOQ-FOWTUZBSSA-N |
| XLogP | 0.19 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|