C14H15F2N3O3 — CID 161485138
[2-(2,6-difluorophenyl)-2-oxoethyl] 3-amino-2-(N'-ethylcarbamimidoyl)prop-2-enoate (PubChem CID 161485138) has the molecular formula C14H15F2N3O3 and a molecular weight of 311.29 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-2-oxoethyl] 3-amino-2-(N'-ethylcarbamimidoyl)prop-2-enoate.
| Compound Name | [2-(2,6-difluorophenyl)-2-oxoethyl] 3-amino-2-(N'-ethylcarbamimidoyl)prop-2-enoate |
|---|---|
| PubChem CID | 161485138 |
| Molecular Formula | C14H15F2N3O3 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [2-(2,6-difluorophenyl)-2-oxoethyl] 3-amino-2-(N'-ethylcarbamimidoyl)prop-2-enoate |
| SMILES | CC/N=C(\N)C(=CN)C(=O)OCC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H15F2N3O3/c1-2-19-13(18)8(6-17)14(21)22-7-11(20)12-9(15)4-3-5-10(12)16/h3-6H,2,7,17H2,1H3,(H2,18,19) |
| InChIKey | DEROJFYWMCJNEA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|