C14H13F4N3O3 — CID 154613484
[2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-4,4-difluoro-2-(N'-methylcarbamimidoyl)but-2-enoate (PubChem CID 154613484) has the molecular formula C14H13F4N3O3 and a molecular weight of 347.27 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-4,4-difluoro-2-(N'-methylcarbamimidoyl)but-2-enoate.
| Compound Name | [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-4,4-difluoro-2-(N'-methylcarbamimidoyl)but-2-enoate |
|---|---|
| PubChem CID | 154613484 |
| Molecular Formula | C14H13F4N3O3 |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | [2-(2,6-difluorophenyl)-2-oxoethyl] (E)-3-amino-4,4-difluoro-2-(N'-methylcarbamimidoyl)but-2-enoate |
| SMILES | C/N=C(N)/C(C(=O)OCC(=O)c1c(F)cccc1F)=C(\N)C(F)F |
| InChI | InChI=1S/C14H13F4N3O3/c1-21-13(20)10(11(19)12(17)18)14(23)24-5-8(22)9-6(15)3-2-4-7(9)16/h2-4,12H,5,19H2,1H3,(H2,20,21)/b11-10+ |
| InChIKey | CUQXKUJHUGTQQT-ZHACJKMWSA-N |
| XLogP | 1.16 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|