C20H28ClN5O3 — CID 160762902
[2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]pent-2-enoate (PubChem CID 160762902) has the molecular formula C20H28ClN5O3 and a molecular weight of 421.93 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]pent-2-enoate.
| Compound Name | [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]pent-2-enoate |
|---|---|
| PubChem CID | 160762902 |
| Molecular Formula | C20H28ClN5O3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-(2-chlorophenyl)-2-oxoethyl] 3-amino-2-[N'-(2-piperazin-1-ylethyl)carbamimidoyl]pent-2-enoate |
| SMILES | CCC(N)=C(C(=O)OCC(=O)c1ccccc1Cl)/C(N)=N/CCN1CCNCC1 |
| InChI | InChI=1S/C20H28ClN5O3/c1-2-16(22)18(19(23)25-9-12-26-10-7-24-8-11-26)20(28)29-13-17(27)14-5-3-4-6-15(14)21/h3-6,24H,2,7-13,22H2,1H3,(H2,23,25) |
| InChIKey | IAOBRVFGZZXQAJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|