C11H10N2OS2 — CID 15306310
(6Z)-6-benzylidene-2-methylsulfanyl-4H-1,3,4-thiadiazin-5-one (PubChem CID 15306310) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is (6Z)-6-benzylidene-2-methylsulfanyl-4H-1,3,4-thiadiazin-5-one.
| Compound Name | (6Z)-6-benzylidene-2-methylsulfanyl-4H-1,3,4-thiadiazin-5-one |
|---|---|
| PubChem CID | 15306310 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (6Z)-6-benzylidene-2-methylsulfanyl-4H-1,3,4-thiadiazin-5-one |
| SMILES | CSC1=NNC(=O)/C(=C/c2ccccc2)S1 |
| InChI | InChI=1S/C11H10N2OS2/c1-15-11-13-12-10(14)9(16-11)7-8-5-3-2-4-6-8/h2-7H,1H3,(H,12,14)/b9-7- |
| InChIKey | SPFNXJAAOPFWQQ-CLFYSBASSA-N |
| XLogP | 2.52 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|