C7H9F3N2O2 — CID 153085878
2-(aminomethylidene)-3-(2,2,2-trifluoroethylimino)butanoic acid (PubChem CID 153085878) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. Its IUPAC name is 2-(aminomethylidene)-3-(2,2,2-trifluoroethylimino)butanoic acid.
| Compound Name | 2-(aminomethylidene)-3-(2,2,2-trifluoroethylimino)butanoic acid |
|---|---|
| PubChem CID | 153085878 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-(aminomethylidene)-3-(2,2,2-trifluoroethylimino)butanoic acid |
| SMILES | C/C(=N\CC(F)(F)F)C(=CN)C(=O)O |
| InChI | InChI=1S/C7H9F3N2O2/c1-4(5(2-11)6(13)14)12-3-7(8,9)10/h2H,3,11H2,1H3,(H,13,14)/b5-2?,12-4+ |
| InChIKey | LDCXHKOUAMWDQG-OCNJVKKDSA-N |
| XLogP | 0.94 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|