C14H14F5N3O — CID 177032982
3-[(Z)-2-amino-4-(2,2,2-trifluoroethylimino)pent-2-en-3-yl]-2,6-difluorobenzamide (PubChem CID 177032982) has the molecular formula C14H14F5N3O and a molecular weight of 335.28 g/mol. Its IUPAC name is 3-[(Z)-2-amino-4-(2,2,2-trifluoroethylimino)pent-2-en-3-yl]-2,6-difluorobenzamide.
| Compound Name | 3-[(Z)-2-amino-4-(2,2,2-trifluoroethylimino)pent-2-en-3-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 177032982 |
| Molecular Formula | C14H14F5N3O |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-[(Z)-2-amino-4-(2,2,2-trifluoroethylimino)pent-2-en-3-yl]-2,6-difluorobenzamide |
| SMILES | C/C(N)=C(C(/C)=N/CC(F)(F)F)\c1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C14H14F5N3O/c1-6(20)10(7(2)22-5-14(17,18)19)8-3-4-9(15)11(12(8)16)13(21)23/h3-4H,5,20H2,1-2H3,(H2,21,23)/b10-6+,22-7+ |
| InChIKey | HRKRAFPAKGENBV-SIGVMNMTSA-N |
| XLogP | 2.78 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|