C24H20FN5O2 — CID 153094530
(6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(5-methyl-1,2,4-oxadiazol-3-yl)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one (PubChem CID 153094530) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(5-methyl-1,2,4-oxadiazol-3-yl)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(5-methyl-1,2,4-oxadiazol-3-yl)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 153094530 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-9-isocyano-7,10a-dimethyl-2-(5-methyl-1,2,4-oxadiazol-3-yl)-5,6,6a,7-tetrahydrobenzo[h]quinazolin-8-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)c3nc(-c4noc(C)n4)nc(-c4ccccc4F)c3CC[C@@H]2[C@@H](C)C1=O |
| InChI | InChI=1S/C24H20FN5O2/c1-12-16-10-9-15-19(14-7-5-6-8-17(14)25)28-22(23-27-13(2)32-30-23)29-21(15)24(16,3)11-18(26-4)20(12)31/h5-8,11-12,16H,9-10H2,1-3H3/t12-,16-,24-/m1/s1 |
| InChIKey | VPVMCNXGDMZHSA-FQVCVTIRSA-N |
| XLogP | 4.48 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|